C33H30F8N4O — CID 138698562
N-[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]acetamide (PubChem CID 138698562) has the molecular formula C33H30F8N4O and a molecular weight of 650.61 g/mol. Its IUPAC name is N-[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]acetamide.
| Compound Name | N-[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 138698562 |
| Molecular Formula | C33H30F8N4O |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | N-[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]acetamide |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(NC(C)=O)cc1F)CN(Cc1ccc(C(F)(F)F)cc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C33H30F8N4O/c1-4-19-7-6-8-20(5-2)30(19)45-31(23-14-27(35)29(15-26(23)34)42-18(3)46)24-17-44(12-11-28(24)43-45)16-21-9-10-22(32(36,37)38)13-25(21)33(39,40)41/h6-10,13-15H,4-5,11-12,16-17H2,1-3H3,(H,42,46) |
| InChIKey | ARQFLOWOMUMRDP-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |