C10H17NO5 — CID 138698588
4-acetyloxybutanoic acid;3,3-dimethylaziridin-2-one (PubChem CID 138698588) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-acetyloxybutanoic acid;3,3-dimethylaziridin-2-one.
| Compound Name | 4-acetyloxybutanoic acid;3,3-dimethylaziridin-2-one |
|---|---|
| PubChem CID | 138698588 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 4-acetyloxybutanoic acid;3,3-dimethylaziridin-2-one |
| SMILES | CC(=O)OCCCC(=O)O.CC1(C)NC1=O |
| InChI | InChI=1S/C6H10O4.C4H7NO/c1-5(7)10-4-2-3-6(8)9;1-4(2)3(6)5-4/h2-4H2,1H3,(H,8,9);1-2H3,(H,5,6) |
| InChIKey | MNHPABOXCQHTDH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|