About 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine
1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine (PubChem CID 138698707) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
Molecular Properties
| Compound Name | 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| PubChem CID | 138698707 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C(=N\C=C/C)c1cccc2c1oc1cccnc12 |
| InChI | InChI=1S/C17H14N2O/c1-3-10-18-14(4-2)12-7-5-8-13-16-15(20-17(12)13)9-6-11-19-16/h3-11H,2H2,1H3/b10-3-,18-14+ |
| InChIKey | GHBCDNPBFGXHLN-KMCTZSNLSA-N |
| XLogP | 4.49 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
The IUPAC name of 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine (CID 138698707) is 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
What is the SMILES notation for 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
The canonical SMILES for 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine is C=C/C(=N\C=C/C)c1cccc2c1oc1cccnc12.
What is the InChIKey of 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
The InChIKey is GHBCDNPBFGXHLN-KMCTZSNLSA-N. The full InChI is InChI=1S/C17H14N2O/c1-3-10-18-14(4-2)12-7-5-8-13-16-15(20-17(12)13)9-6-11-19-16/h3-11H,2H2,1H3/b10-3-,18-14+.
What are the key properties of 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine has a molecular weight of 262.31 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1]benzofuro[3,2-b]pyridin-6-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine is sourced from PubChem (CID 138698707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).