C28H33ClF6N2 — CID 138698934
(1E,3E,4Z,6Z)-N-[(E)-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-6-chloro-N-ethenyl-3-ethylidene-2,7-dimethylnona-1,4,6-trien-1-amine (PubChem CID 138698934) has the molecular formula C28H33ClF6N2 and a molecular weight of 547.03 g/mol. Its IUPAC name is (1E,3E,4Z,6Z)-N-[(E)-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-6-chloro-N-ethenyl-3-ethylidene-2,7-dimethylnona-1,4,6-trien-1-amine.
| Compound Name | (1E,3E,4Z,6Z)-N-[(E)-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-6-chloro-N-ethenyl-3-ethylidene-2,7-dimethylnona-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 138698934 |
| Molecular Formula | C28H33ClF6N2 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (1E,3E,4Z,6Z)-N-[(E)-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-6-chloro-N-ethenyl-3-ethylidene-2,7-dimethylnona-1,4,6-trien-1-amine |
| SMILES | C=CN(/C=C(C)/C(/C=C\C(Cl)=C(/C)CC)=C/C)/N=C(/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)CC |
| InChI | InChI=1S/C28H33ClF6N2/c1-8-18(5)25(29)13-12-21(10-3)20(7)17-37(11-4)36-26(19(6)9-2)22-14-23(27(30,31)32)16-24(15-22)28(33,34)35/h10-17,19H,4,8-9H2,1-3,5-7H3/b13-12-,20-17+,21-10+,25-18-,36-26+ |
| InChIKey | BHKOEQUNJBYVRH-GBACAAHNSA-N |
| XLogP | 10.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|