C20H24ClFN4O11P2 — CID 138699029
5-amino-8-chloro-1-cyclopropyl-7-[3-(1,1-diphosphonoethoxycarbonylamino)pyrrolidin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 138699029) has the molecular formula C20H24ClFN4O11P2 and a molecular weight of 612.83 g/mol. Its IUPAC name is 5-amino-8-chloro-1-cyclopropyl-7-[3-(1,1-diphosphonoethoxycarbonylamino)pyrrolidin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-8-chloro-1-cyclopropyl-7-[3-(1,1-diphosphonoethoxycarbonylamino)pyrrolidin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 138699029 |
| Molecular Formula | C20H24ClFN4O11P2 |
| Molecular Weight | 612.83 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | 5-amino-8-chloro-1-cyclopropyl-7-[3-(1,1-diphosphonoethoxycarbonylamino)pyrrolidin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC(OC(=O)NC1CCN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2Cl)C1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C20H24ClFN4O11P2/c1-20(38(31,32)33,39(34,35)36)37-19(30)24-8-4-5-25(6-8)16-12(21)15-11(14(23)13(16)22)17(27)10(18(28)29)7-26(15)9-2-3-9/h7-9H,2-6,23H2,1H3,(H,24,30)(H,28,29)(H2,31,32,33)(H2,34,35,36) |
| InChIKey | LOZJHCXKSWVMQV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 241.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.83 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|