About 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide
1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide (PubChem CID 1387) has the molecular formula C8H8N2O3S2
and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide |
| PubChem CID | 1387 |
| Molecular Formula | C8H8N2O3S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide |
| SMILES | Cn1sc(=O)c2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C8H8N2O3S2/c1-10-7-3-2-5(15(9,12)13)4-6(7)8(11)14-10/h2-4H,1H3,(H2,9,12,13) |
| InChIKey | DFPYCCVFXMWMJM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide?
The IUPAC name of 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide (CID 1387) is 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide.
What is the SMILES notation for 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide?
The canonical SMILES for 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide is Cn1sc(=O)c2cc(S(N)(=O)=O)ccc21.
What is the InChIKey of 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide?
The InChIKey is DFPYCCVFXMWMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S2/c1-10-7-3-2-5(15(9,12)13)4-6(7)8(11)14-10/h2-4H,1H3,(H2,9,12,13).
What are the key properties of 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide?
1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide has a molecular weight of 244.30 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-oxo-2,1-benzothiazole-5-sulfonamide is sourced from PubChem (CID 1387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).