C31H31Cl2F5N2O4 — CID 138700067
2-[(2S,4R)-1-[5-cyclopropyl-4-[[1-[(1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]piperidin-4-yl]methoxy]-2-fluorobenzoyl]-4-fluoropyrrolidin-2-yl]prop-2-enoic acid (PubChem CID 138700067) has the molecular formula C31H31Cl2F5N2O4 and a molecular weight of 661.50 g/mol. Its IUPAC name is 2-[(2S,4R)-1-[5-cyclopropyl-4-[[1-[(1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]piperidin-4-yl]methoxy]-2-fluorobenzoyl]-4-fluoropyrrolidin-2-yl]prop-2-enoic acid.
| Compound Name | 2-[(2S,4R)-1-[5-cyclopropyl-4-[[1-[(1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]piperidin-4-yl]methoxy]-2-fluorobenzoyl]-4-fluoropyrrolidin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138700067 |
| Molecular Formula | C31H31Cl2F5N2O4 |
| Molecular Weight | 661.50 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 2-[(2S,4R)-1-[5-cyclopropyl-4-[[1-[(1R)-1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]piperidin-4-yl]methoxy]-2-fluorobenzoyl]-4-fluoropyrrolidin-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@@H]1C[C@@H](F)CN1C(=O)c1cc(C2CC2)c(OCC2CCN([C@H](c3cc(Cl)cc(Cl)c3)C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C31H31Cl2F5N2O4/c1-16(30(42)43)26-11-22(34)14-40(26)29(41)24-12-23(18-2-3-18)27(13-25(24)35)44-15-17-4-6-39(7-5-17)28(31(36,37)38)19-8-20(32)10-21(33)9-19/h8-10,12-13,17-18,22,26,28H,1-7,11,14-15H2,(H,42,43)/t22-,26+,28-/m1/s1 |
| InChIKey | SALYNNRPKSPMFR-AEAGWUPHSA-N |
| XLogP | 7.60 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.50 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|