C21H14F4N4O2S — CID 138700309
N-[2,4-difluoro-3-[(E)-3-methyl-4-[5-(methylideneamino)-1H-pyrazol-4-yl]but-3-en-1-ynyl]phenyl]-2,6-difluorobenzenesulfonamide (PubChem CID 138700309) has the molecular formula C21H14F4N4O2S and a molecular weight of 462.43 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[(E)-3-methyl-4-[5-(methylideneamino)-1H-pyrazol-4-yl]but-3-en-1-ynyl]phenyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[2,4-difluoro-3-[(E)-3-methyl-4-[5-(methylideneamino)-1H-pyrazol-4-yl]but-3-en-1-ynyl]phenyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 138700309 |
| Molecular Formula | C21H14F4N4O2S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[2,4-difluoro-3-[(E)-3-methyl-4-[5-(methylideneamino)-1H-pyrazol-4-yl]but-3-en-1-ynyl]phenyl]-2,6-difluorobenzenesulfonamide |
| SMILES | C=Nc1[nH]ncc1/C=C(\C)C#Cc1c(F)ccc(NS(=O)(=O)c2c(F)cccc2F)c1F |
| InChI | InChI=1S/C21H14F4N4O2S/c1-12(10-13-11-27-28-21(13)26-2)6-7-14-15(22)8-9-18(19(14)25)29-32(30,31)20-16(23)4-3-5-17(20)24/h3-5,8-11,29H,2H2,1H3,(H,27,28)/b12-10+ |
| InChIKey | WJADEAYYTCKSTK-ZRDIBKRKSA-N |
| XLogP | 4.55 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|