C27H19Cl2N3O2S2 — CID 138700360
5-[[5-(4-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 138700360) has the molecular formula C27H19Cl2N3O2S2 and a molecular weight of 552.51 g/mol. Its IUPAC name is 5-[[5-(4-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(4-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 138700360 |
| Molecular Formula | C27H19Cl2N3O2S2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 5-[[5-(4-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(=Cc2ccc(N(c3ccc(Cl)cc3)c3ccc(Cl)c4ccccc34)s2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C27H19Cl2N3O2S2/c1-30-25(33)21(26(34)31(2)27(30)35)15-18-11-14-24(36-18)32(17-9-7-16(28)8-10-17)23-13-12-22(29)19-5-3-4-6-20(19)23/h3-15H,1-2H3 |
| InChIKey | QTLZAGPJZLKVPF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|