C60H33F4N9 — CID 138700395
9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3,5,6-tetrafluorophenyl]-2,6-bis(pyrido[3,4-b]indol-9-yl)phenyl]pyrido[3,4-b]indole (PubChem CID 138700395) has the molecular formula C60H33F4N9 and a molecular weight of 955.98 g/mol. Its IUPAC name is 9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3,5,6-tetrafluorophenyl]-2,6-bis(pyrido[3,4-b]indol-9-yl)phenyl]pyrido[3,4-b]indole.
| Compound Name | 9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3,5,6-tetrafluorophenyl]-2,6-bis(pyrido[3,4-b]indol-9-yl)phenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 138700395 |
| Molecular Formula | C60H33F4N9 |
| Molecular Weight | 955.98 g/mol |
| Exact Mass | 955.28 |
| IUPAC Name | 9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3,5,6-tetrafluorophenyl]-2,6-bis(pyrido[3,4-b]indol-9-yl)phenyl]pyrido[3,4-b]indole |
| SMILES | Fc1c(F)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(F)c(F)c1-c1cc(-n2c3ccccc3c3ccncc32)c(-n2c3ccccc3c3ccncc32)c(-n2c3ccccc3c3ccncc32)c1 |
| InChI | InChI=1S/C60H33F4N9/c61-53-51(54(62)56(64)52(55(53)63)60-69-58(34-13-3-1-4-14-34)68-59(70-60)35-15-5-2-6-16-35)36-29-46(71-43-20-10-7-17-37(43)40-23-26-65-31-48(40)71)57(73-45-22-12-9-19-39(45)42-25-28-67-33-50(42)73)47(30-36)72-44-21-11-8-18-38(44)41-24-27-66-32-49(41)72/h1-33H |
| InChIKey | ULMQIKYFFINFMG-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.98 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|