C23H48N4O — CID 138700667
4-methylidene-1-(1,4,8,12-tetrazacyclopentadec-1-yl)undecan-2-ol (PubChem CID 138700667) has the molecular formula C23H48N4O and a molecular weight of 396.66 g/mol. Its IUPAC name is 4-methylidene-1-(1,4,8,12-tetrazacyclopentadec-1-yl)undecan-2-ol.
| Compound Name | 4-methylidene-1-(1,4,8,12-tetrazacyclopentadec-1-yl)undecan-2-ol |
|---|---|
| PubChem CID | 138700667 |
| Molecular Formula | C23H48N4O |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | 4-methylidene-1-(1,4,8,12-tetrazacyclopentadec-1-yl)undecan-2-ol |
| SMILES | C=C(CCCCCCC)CC(O)CN1CCCNCCCNCCCNCC1 |
| InChI | InChI=1S/C23H48N4O/c1-3-4-5-6-7-11-22(2)20-23(28)21-27-18-10-16-25-14-8-12-24-13-9-15-26-17-19-27/h23-26,28H,2-21H2,1H3 |
| InChIKey | VFJPFWGEYFEQOA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|