C27H23IO6 — CID 138700696
5-(4-iodobutoxy)-7-[(5-methoxy-1,4-dioxonaphthalen-2-yl)methyl]-2-methylnaphthalene-1,4-dione (PubChem CID 138700696) has the molecular formula C27H23IO6 and a molecular weight of 570.38 g/mol. Its IUPAC name is 5-(4-iodobutoxy)-7-[(5-methoxy-1,4-dioxonaphthalen-2-yl)methyl]-2-methylnaphthalene-1,4-dione.
| Compound Name | 5-(4-iodobutoxy)-7-[(5-methoxy-1,4-dioxonaphthalen-2-yl)methyl]-2-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 138700696 |
| Molecular Formula | C27H23IO6 |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | 5-(4-iodobutoxy)-7-[(5-methoxy-1,4-dioxonaphthalen-2-yl)methyl]-2-methylnaphthalene-1,4-dione |
| SMILES | COc1cccc2c1C(=O)C=C(Cc1cc(OCCCCI)c3c(c1)C(=O)C(C)=CC3=O)C2=O |
| InChI | InChI=1S/C27H23IO6/c1-15-10-20(29)25-19(26(15)31)12-16(13-23(25)34-9-4-3-8-28)11-17-14-21(30)24-18(27(17)32)6-5-7-22(24)33-2/h5-7,10,12-14H,3-4,8-9,11H2,1-2H3 |
| InChIKey | RROYXZMGXSOQRN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|