C20H33N — CID 138700838
(2Z)-N,7,10,11-tetramethyl-5-methylidene-4-propan-2-ylidenedodeca-2,10-dien-1-imine (PubChem CID 138700838) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is (2Z)-N,7,10,11-tetramethyl-5-methylidene-4-propan-2-ylidenedodeca-2,10-dien-1-imine.
| Compound Name | (2Z)-N,7,10,11-tetramethyl-5-methylidene-4-propan-2-ylidenedodeca-2,10-dien-1-imine |
|---|---|
| PubChem CID | 138700838 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (2Z)-N,7,10,11-tetramethyl-5-methylidene-4-propan-2-ylidenedodeca-2,10-dien-1-imine |
| SMILES | C=C(CC(C)CCC(C)=C(C)C)C(/C=C\C=N\C)=C(C)C |
| InChI | InChI=1S/C20H33N/c1-15(2)18(6)12-11-17(5)14-19(7)20(16(3)4)10-9-13-21-8/h9-10,13,17H,7,11-12,14H2,1-6,8H3/b10-9-,21-13+ |
| InChIKey | VBFSGRAJVDDOOL-DRJJNECNSA-N |
| XLogP | 6.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|