About US10703755, Example 40
US10703755, Example 40 (PubChem CID 138700848) has the molecular formula C25H27FN8O2
and a molecular weight of 490.50 g/mol. Its IUPAC name is 9-[[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-3-pyridinyl]methyl]-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-6-amine.
Molecular Properties
| Compound Name | US10703755, Example 40 |
| PubChem CID | 138700848 |
| Molecular Formula | C25H27FN8O2 |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 9-[[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-3-pyridinyl]methyl]-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-6-amine |
| SMILES | CCOC1=NC(=C2C(=N1)N(C(=N2)C3=CC(=CN=C3)F)CC4=CN=C(C=C4)O[C@@H]5CN6CCC5CC6)N |
| InChI | InChI=1S/C25H27FN8O2/c1-2-35-25-31-22(27)21-24(32-25)34(23(30-21)17-9-18(26)12-28-11-17)13-15-3-4-20(29-10-15)36-19-14-33-7-5-16(19)6-8-33/h3-4,9-12,16,19H,2,5-8,13-14H2,1H3,(H2,27,31,32)/t19-/m1/s1 |
| InChIKey | YWOSGUQYWKGYIA-LJQANCHMSA-N |
| XLogP | 2.50 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | 730 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US10703755, Example 40 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10703755, Example 40?
The IUPAC name of US10703755, Example 40 (CID 138700848) is 9-[[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-3-pyridinyl]methyl]-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-6-amine.
What is the SMILES notation for US10703755, Example 40?
The canonical SMILES for US10703755, Example 40 is CCOC1=NC(=C2C(=N1)N(C(=N2)C3=CC(=CN=C3)F)CC4=CN=C(C=C4)O[C@@H]5CN6CCC5CC6)N.
What is the InChIKey of US10703755, Example 40?
The InChIKey is YWOSGUQYWKGYIA-LJQANCHMSA-N. The full InChI is InChI=1S/C25H27FN8O2/c1-2-35-25-31-22(27)21-24(32-25)34(23(30-21)17-9-18(26)12-28-11-17)13-15-3-4-20(29-10-15)36-19-14-33-7-5-16(19)6-8-33/h3-4,9-12,16,19H,2,5-8,13-14H2,1H3,(H2,27,31,32)/t19-/m1/s1.
What are the key properties of US10703755, Example 40?
US10703755, Example 40 has a molecular weight of 490.50 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US10703755, Example 40 is sourced from PubChem (CID 138700848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).