C11H16FN — CID 138701382
(2R,4S)-4-fluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine (PubChem CID 138701382) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (2R,4S)-4-fluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine.
| Compound Name | (2R,4S)-4-fluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 138701382 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (2R,4S)-4-fluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine |
| SMILES | C=C(/C=C\C=C/C)[C@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C11H16FN/c1-3-4-5-6-9(2)11-7-10(12)8-13-11/h3-6,10-11,13H,2,7-8H2,1H3/b4-3-,6-5-/t10-,11+/m0/s1 |
| InChIKey | MZRYLTYBGBMOGV-JXYSBEDYSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|