About 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol
2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol (PubChem CID 138701451) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol.
Molecular Properties
| Compound Name | 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol |
| PubChem CID | 138701451 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol |
| SMILES | C[C@@H]1C=C[C@@H](N)[C@@H]1OC(C)(C)O |
| InChI | InChI=1S/C9H17NO2/c1-6-4-5-7(10)8(6)12-9(2,3)11/h4-8,11H,10H2,1-3H3/t6-,7-,8-/m1/s1 |
| InChIKey | UEWBXUDCWZAVCH-BWZBUEFSSA-N |
| XLogP | 0.63 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol?
The IUPAC name of 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol (CID 138701451) is 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol.
What is the SMILES notation for 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol?
The canonical SMILES for 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol is C[C@@H]1C=C[C@@H](N)[C@@H]1OC(C)(C)O.
What is the InChIKey of 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol?
The InChIKey is UEWBXUDCWZAVCH-BWZBUEFSSA-N. The full InChI is InChI=1S/C9H17NO2/c1-6-4-5-7(10)8(6)12-9(2,3)11/h4-8,11H,10H2,1-3H3/t6-,7-,8-/m1/s1.
What are the key properties of 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol?
2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol has a molecular weight of 171.24 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R,5R)-2-amino-5-methylcyclopent-3-en-1-yl]oxypropan-2-ol is sourced from PubChem (CID 138701451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).