C11H14F3N — CID 138701471
(2R,4S)-2-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-4-fluoropyrrolidine (PubChem CID 138701471) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is (2R,4S)-2-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-4-fluoropyrrolidine.
| Compound Name | (2R,4S)-2-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-4-fluoropyrrolidine |
|---|---|
| PubChem CID | 138701471 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2R,4S)-2-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-4-fluoropyrrolidine |
| SMILES | C=C(/C(F)=C(F)\C=C/C)[C@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C11H14F3N/c1-3-4-9(13)11(14)7(2)10-5-8(12)6-15-10/h3-4,8,10,15H,2,5-6H2,1H3/b4-3-,11-9-/t8-,10+/m0/s1 |
| InChIKey | KOUNOHQSBNMQEG-SNLLCLOBSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|