C16H23F2NO3 — CID 138701537
tert-butyl (2R,4R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 138701537) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138701537 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | C=C(/C(F)=C\C=C(/C)F)[C@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23F2NO3/c1-10(17)6-7-13(18)11(2)14-8-12(20)9-19(14)15(21)22-16(3,4)5/h6-7,12,14,20H,2,8-9H2,1,3-5H3/b10-6+,13-7+/t12-,14-/m1/s1 |
| InChIKey | WPAPDDZXFPACCN-BWPRMXFLSA-N |
| XLogP | 3.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|