C20H15Cl2F3N4 — CID 138701953
N'-[[2-cyano-4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]ethanimidamide (PubChem CID 138701953) has the molecular formula C20H15Cl2F3N4 and a molecular weight of 439.27 g/mol. Its IUPAC name is N'-[[2-cyano-4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]ethanimidamide.
| Compound Name | N'-[[2-cyano-4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]ethanimidamide |
|---|---|
| PubChem CID | 138701953 |
| Molecular Formula | C20H15Cl2F3N4 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N'-[[2-cyano-4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]ethanimidamide |
| SMILES | C/C(N)=N\C=N\c1ccc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C20H15Cl2F3N4/c1-12(27)28-11-29-19-5-3-13(6-15(19)10-26)2-4-18(20(23,24)25)14-7-16(21)9-17(22)8-14/h2-9,11,18H,1H3,(H2,27,28,29)/b4-2+ |
| InChIKey | BDMHDOHYGDGTOO-DUXPYHPUSA-N |
| XLogP | 6.26 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|