About 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one
7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one (PubChem CID 138702179) has the molecular formula C6H9IN2O2
and a molecular weight of 268.05 g/mol. Its IUPAC name is 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one.
Molecular Properties
| Compound Name | 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
| PubChem CID | 138702179 |
| Molecular Formula | C6H9IN2O2 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
| SMILES | O=C1NCC2(CCN(I)C2)O1 |
| InChI | InChI=1S/C6H9IN2O2/c7-9-2-1-6(4-9)3-8-5(10)11-6/h1-4H2,(H,8,10) |
| InChIKey | ADVLAPLIWGNWAP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
The IUPAC name of 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one (CID 138702179) is 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one.
What is the SMILES notation for 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
The canonical SMILES for 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one is O=C1NCC2(CCN(I)C2)O1.
What is the InChIKey of 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
The InChIKey is ADVLAPLIWGNWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2O2/c7-9-2-1-6(4-9)3-8-5(10)11-6/h1-4H2,(H,8,10).
What are the key properties of 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one has a molecular weight of 268.05 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-1-oxa-3,7-diazaspiro[4.4]nonan-2-one is sourced from PubChem (CID 138702179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).