C26H34N6O — CID 138702418
N-heptan-4-yl-N-methyl-4-[[8-(1,2,3,6-tetrahydropyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide (PubChem CID 138702418) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is N-heptan-4-yl-N-methyl-4-[[8-(1,2,3,6-tetrahydropyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide.
| Compound Name | N-heptan-4-yl-N-methyl-4-[[8-(1,2,3,6-tetrahydropyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 138702418 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | N-heptan-4-yl-N-methyl-4-[[8-(1,2,3,6-tetrahydropyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
| SMILES | CCCC(CCC)N(C)C(=O)c1ccc(Nc2nc3c(C4=CCNCC4)cccn3n2)cc1 |
| InChI | InChI=1S/C26H34N6O/c1-4-7-22(8-5-2)31(3)25(33)20-10-12-21(13-11-20)28-26-29-24-23(9-6-18-32(24)30-26)19-14-16-27-17-15-19/h6,9-14,18,22,27H,4-5,7-8,15-17H2,1-3H3,(H,28,30) |
| InChIKey | CKRXHHSMISPDED-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |