C8H13F3N2O — CID 138702838
(1E,3Z)-1-(2,2,2-trifluoroethoxy)hexa-1,3-diene-1,4-diamine (PubChem CID 138702838) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is (1E,3Z)-1-(2,2,2-trifluoroethoxy)hexa-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(2,2,2-trifluoroethoxy)hexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 138702838 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (1E,3Z)-1-(2,2,2-trifluoroethoxy)hexa-1,3-diene-1,4-diamine |
| SMILES | CC/C(N)=C/C=C(\N)OCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O/c1-2-6(12)3-4-7(13)14-5-8(9,10)11/h3-4H,2,5,12-13H2,1H3/b6-3-,7-4+ |
| InChIKey | AECGIVIWUXZPQA-UCZKPGLMSA-N |
| XLogP | 1.62 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|