About 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine
2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine (PubChem CID 138702880) has the molecular formula C12H21FN2
and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine.
Molecular Properties
| Compound Name | 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine |
| PubChem CID | 138702880 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine |
| SMILES | CCC1C=NC(C(C)(F)CC)=C(C)N1C |
| InChI | InChI=1S/C12H21FN2/c1-6-10-8-14-11(9(3)15(10)5)12(4,13)7-2/h8,10H,6-7H2,1-5H3 |
| InChIKey | PCWMRTPDUVXRQU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine?
The IUPAC name of 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine (CID 138702880) is 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine.
What is the SMILES notation for 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine?
The canonical SMILES for 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine is CCC1C=NC(C(C)(F)CC)=C(C)N1C.
What is the InChIKey of 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine?
The InChIKey is PCWMRTPDUVXRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21FN2/c1-6-10-8-14-11(9(3)15(10)5)12(4,13)7-2/h8,10H,6-7H2,1-5H3.
What are the key properties of 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine?
2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine has a molecular weight of 212.31 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-(2-fluorobutan-2-yl)-1,6-dimethyl-2H-pyrazine is sourced from PubChem (CID 138702880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).