C20H27F4N5O3 — CID 138702907
(2Z,4E)-2,5-diamino-N-[1-[2-methyl-6-(2-methylpropanoylamino)-4-pyridinyl]ethyl]-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide (PubChem CID 138702907) has the molecular formula C20H27F4N5O3 and a molecular weight of 461.46 g/mol. Its IUPAC name is (2Z,4E)-2,5-diamino-N-[1-[2-methyl-6-(2-methylpropanoylamino)-4-pyridinyl]ethyl]-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide.
| Compound Name | (2Z,4E)-2,5-diamino-N-[1-[2-methyl-6-(2-methylpropanoylamino)-4-pyridinyl]ethyl]-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide |
|---|---|
| PubChem CID | 138702907 |
| Molecular Formula | C20H27F4N5O3 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (2Z,4E)-2,5-diamino-N-[1-[2-methyl-6-(2-methylpropanoylamino)-4-pyridinyl]ethyl]-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide |
| SMILES | Cc1cc(C(C)NC(=O)/C(N)=C/C=C(\N)OCC(F)(F)C(F)F)cc(NC(=O)C(C)C)n1 |
| InChI | InChI=1S/C20H27F4N5O3/c1-10(2)17(30)29-16-8-13(7-11(3)27-16)12(4)28-18(31)14(25)5-6-15(26)32-9-20(23,24)19(21)22/h5-8,10,12,19H,9,25-26H2,1-4H3,(H,28,31)(H,27,29,30)/b14-5-,15-6+ |
| InChIKey | ZJYHKTODDJLOGC-YOENDLTHSA-N |
| XLogP | 2.72 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|