About (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine
(E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine (PubChem CID 138702998) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine.
Molecular Properties
| Compound Name | (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine |
| PubChem CID | 138702998 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine |
| SMILES | C=C/C(=C\C=N\CCC(C)C(C)C)C(C)N |
| InChI | InChI=1S/C14H26N2/c1-6-14(13(5)15)8-10-16-9-7-12(4)11(2)3/h6,8,10-13H,1,7,9,15H2,2-5H3/b14-8+,16-10+ |
| InChIKey | JLNVRZGUJHHOPJ-ZMBCDGQDSA-N |
| XLogP | 3.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine?
The IUPAC name of (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine (CID 138702998) is (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine.
What is the SMILES notation for (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine?
The canonical SMILES for (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine is C=C/C(=C\C=N\CCC(C)C(C)C)C(C)N.
What is the InChIKey of (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine?
The InChIKey is JLNVRZGUJHHOPJ-ZMBCDGQDSA-N. The full InChI is InChI=1S/C14H26N2/c1-6-14(13(5)15)8-10-16-9-7-12(4)11(2)3/h6,8,10-13H,1,7,9,15H2,2-5H3/b14-8+,16-10+.
What are the key properties of (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine?
(E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine has a molecular weight of 222.38 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(3,4-dimethylpentylimino)-3-ethenylpent-3-en-2-amine is sourced from PubChem (CID 138702998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).