C14H23F3N2 — CID 138703055
[(Z)-1-(4-ethylcyclohexylidene)-6,6,6-trifluorohex-2-en-3-yl]hydrazine (PubChem CID 138703055) has the molecular formula C14H23F3N2 and a molecular weight of 276.35 g/mol. Its IUPAC name is [(Z)-1-(4-ethylcyclohexylidene)-6,6,6-trifluorohex-2-en-3-yl]hydrazine.
| Compound Name | [(Z)-1-(4-ethylcyclohexylidene)-6,6,6-trifluorohex-2-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 138703055 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | [(Z)-1-(4-ethylcyclohexylidene)-6,6,6-trifluorohex-2-en-3-yl]hydrazine |
| SMILES | CCC1CCC(=C/C=C(/CCC(F)(F)F)NN)CC1 |
| InChI | InChI=1S/C14H23F3N2/c1-2-11-3-5-12(6-4-11)7-8-13(19-18)9-10-14(15,16)17/h7-8,11,19H,2-6,9-10,18H2,1H3/b12-7-,13-8- |
| InChIKey | FBTUPRYZAQZXSD-AJDRMPRJSA-N |
| XLogP | 4.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|