C19H25F4N5O3 — CID 138703131
(2Z,4E)-N-[1-(2-acetamido-6-methyl-4-pyridinyl)ethyl]-2,5-diamino-4-methyl-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide (PubChem CID 138703131) has the molecular formula C19H25F4N5O3 and a molecular weight of 447.43 g/mol. Its IUPAC name is (2Z,4E)-N-[1-(2-acetamido-6-methyl-4-pyridinyl)ethyl]-2,5-diamino-4-methyl-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[1-(2-acetamido-6-methyl-4-pyridinyl)ethyl]-2,5-diamino-4-methyl-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide |
|---|---|
| PubChem CID | 138703131 |
| Molecular Formula | C19H25F4N5O3 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (2Z,4E)-N-[1-(2-acetamido-6-methyl-4-pyridinyl)ethyl]-2,5-diamino-4-methyl-5-(2,2,3,3-tetrafluoropropoxy)penta-2,4-dienamide |
| SMILES | CC(=O)Nc1cc(C(C)NC(=O)/C(N)=C/C(C)=C(\N)OCC(F)(F)C(F)F)cc(C)n1 |
| InChI | InChI=1S/C19H25F4N5O3/c1-9(16(25)31-8-19(22,23)18(20)21)5-14(24)17(30)27-11(3)13-6-10(2)26-15(7-13)28-12(4)29/h5-7,11,18H,8,24-25H2,1-4H3,(H,27,30)(H,26,28,29)/b14-5-,16-9+ |
| InChIKey | KBCBHLXYKKPJCV-ZXDNEXFESA-N |
| XLogP | 2.48 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|