About 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol
2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol (PubChem CID 138703240) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol |
| PubChem CID | 138703240 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol |
| SMILES | CC/C=C\C=C(/C)C(C)NCCO |
| InChI | InChI=1S/C11H21NO/c1-4-5-6-7-10(2)11(3)12-8-9-13/h5-7,11-13H,4,8-9H2,1-3H3/b6-5-,10-7+ |
| InChIKey | IQEQYYXGNTYYSV-ZZWPSLBBSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol?
The IUPAC name of 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol (CID 138703240) is 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol.
What is the SMILES notation for 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol?
The canonical SMILES for 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol is CC/C=C\C=C(/C)C(C)NCCO.
What is the InChIKey of 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol?
The InChIKey is IQEQYYXGNTYYSV-ZZWPSLBBSA-N. The full InChI is InChI=1S/C11H21NO/c1-4-5-6-7-10(2)11(3)12-8-9-13/h5-7,11-13H,4,8-9H2,1-3H3/b6-5-,10-7+.
What are the key properties of 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol?
2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol has a molecular weight of 183.29 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3E,5Z)-3-methylocta-3,5-dien-2-yl]amino]ethanol is sourced from PubChem (CID 138703240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).