C26H28FN7O2S — CID 138703658
6-(3-cyanopyrrolo[1,2-b]pyridazin-7-yl)-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]-4-[(4-isothiocyanatocyclohexyl)amino]pyridine-3-carboxamide (PubChem CID 138703658) has the molecular formula C26H28FN7O2S and a molecular weight of 521.62 g/mol. Its IUPAC name is 6-(3-cyanopyrrolo[1,2-b]pyridazin-7-yl)-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]-4-[(4-isothiocyanatocyclohexyl)amino]pyridine-3-carboxamide.
| Compound Name | 6-(3-cyanopyrrolo[1,2-b]pyridazin-7-yl)-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]-4-[(4-isothiocyanatocyclohexyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138703658 |
| Molecular Formula | C26H28FN7O2S |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 6-(3-cyanopyrrolo[1,2-b]pyridazin-7-yl)-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]-4-[(4-isothiocyanatocyclohexyl)amino]pyridine-3-carboxamide |
| SMILES | CC(C)(O)[C@H](F)CNC(=O)c1cnc(-c2ccc3cc(C#N)cnn23)cc1NC1CCC(N=C=S)CC1 |
| InChI | InChI=1S/C26H28FN7O2S/c1-26(2,36)24(27)14-30-25(35)20-13-29-22(23-8-7-19-9-16(11-28)12-32-34(19)23)10-21(20)33-18-5-3-17(4-6-18)31-15-37/h7-10,12-13,17-18,24,36H,3-6,14H2,1-2H3,(H,29,33)(H,30,35)/t17?,18?,24-/m1/s1 |
| InChIKey | HAEKRTJQGSTXNY-YOHDVBOVSA-N |
| XLogP | 3.93 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|