C21H15F4NO5S — CID 138705356
(2S)-3-[4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluorophenyl]-2-oxo-1,5-dioxa-2λ4-thiaspiro[5.5]undecan-4-one (PubChem CID 138705356) has the molecular formula C21H15F4NO5S and a molecular weight of 469.41 g/mol. Its IUPAC name is (2S)-3-[4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluorophenyl]-2-oxo-1,5-dioxa-2λ4-thiaspiro[5.5]undecan-4-one.
| Compound Name | (2S)-3-[4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluorophenyl]-2-oxo-1,5-dioxa-2λ4-thiaspiro[5.5]undecan-4-one |
|---|---|
| PubChem CID | 138705356 |
| Molecular Formula | C21H15F4NO5S |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (2S)-3-[4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluorophenyl]-2-oxo-1,5-dioxa-2λ4-thiaspiro[5.5]undecan-4-one |
| SMILES | O=C1OC2(CCCCC2)O[S@](=O)C1c1c(F)c(F)c(-c2nc3ccccc3o2)c(F)c1F |
| InChI | InChI=1S/C21H15F4NO5S/c22-14-12(18-20(27)30-21(31-32(18)28)8-4-1-5-9-21)15(23)17(25)13(16(14)24)19-26-10-6-2-3-7-11(10)29-19/h2-3,6-7,18H,1,4-5,8-9H2/t18?,32-/m0/s1 |
| InChIKey | QTAKGNFVYNCALE-VAOGBZHFSA-N |
| XLogP | 4.99 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|