C17H37NO — CID 138705410
3,3,7,7-tetramethyl-2-[methyl(propan-2-yl)amino]nonan-5-ol (PubChem CID 138705410) has the molecular formula C17H37NO and a molecular weight of 271.49 g/mol. Its IUPAC name is 3,3,7,7-tetramethyl-2-[methyl(propan-2-yl)amino]nonan-5-ol.
| Compound Name | 3,3,7,7-tetramethyl-2-[methyl(propan-2-yl)amino]nonan-5-ol |
|---|---|
| PubChem CID | 138705410 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | 3,3,7,7-tetramethyl-2-[methyl(propan-2-yl)amino]nonan-5-ol |
| SMILES | CCC(C)(C)CC(O)CC(C)(C)C(C)N(C)C(C)C |
| InChI | InChI=1S/C17H37NO/c1-10-16(5,6)11-15(19)12-17(7,8)14(4)18(9)13(2)3/h13-15,19H,10-12H2,1-9H3 |
| InChIKey | JPHNPRBIJYLRRC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |