C17H16F3N3O2 — CID 138705592
1-methyl-7-[(2,4,5-trifluorophenyl)methoxy]spiro[3H-imidazo[1,2-c]pyrimidine-2,1'-cyclobutane]-5-one (PubChem CID 138705592) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-methyl-7-[(2,4,5-trifluorophenyl)methoxy]spiro[3H-imidazo[1,2-c]pyrimidine-2,1'-cyclobutane]-5-one.
| Compound Name | 1-methyl-7-[(2,4,5-trifluorophenyl)methoxy]spiro[3H-imidazo[1,2-c]pyrimidine-2,1'-cyclobutane]-5-one |
|---|---|
| PubChem CID | 138705592 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-methyl-7-[(2,4,5-trifluorophenyl)methoxy]spiro[3H-imidazo[1,2-c]pyrimidine-2,1'-cyclobutane]-5-one |
| SMILES | CN1c2cc(OCc3cc(F)c(F)cc3F)nc(=O)n2CC12CCC2 |
| InChI | InChI=1S/C17H16F3N3O2/c1-22-15-7-14(21-16(24)23(15)9-17(22)3-2-4-17)25-8-10-5-12(19)13(20)6-11(10)18/h5-7H,2-4,8-9H2,1H3 |
| InChIKey | GOEFEKHEQOFDGR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|