C25H30N6O3S3 — CID 138705897
2-[2-[[4-[(3S)-3-aminobutyl]-3,6-dioxospiro[2H-pyrrolo[3,4-c]pyridine-1,1'-cyclopropane]-5-yl]methyl]-1,3-thiazol-4-yl]-N-(3-methylsulfanylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 138705897) has the molecular formula C25H30N6O3S3 and a molecular weight of 558.76 g/mol. Its IUPAC name is 2-[2-[[4-[(3S)-3-aminobutyl]-3,6-dioxospiro[2H-pyrrolo[3,4-c]pyridine-1,1'-cyclopropane]-5-yl]methyl]-1,3-thiazol-4-yl]-N-(3-methylsulfanylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-[[4-[(3S)-3-aminobutyl]-3,6-dioxospiro[2H-pyrrolo[3,4-c]pyridine-1,1'-cyclopropane]-5-yl]methyl]-1,3-thiazol-4-yl]-N-(3-methylsulfanylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 138705897 |
| Molecular Formula | C25H30N6O3S3 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2-[2-[[4-[(3S)-3-aminobutyl]-3,6-dioxospiro[2H-pyrrolo[3,4-c]pyridine-1,1'-cyclopropane]-5-yl]methyl]-1,3-thiazol-4-yl]-N-(3-methylsulfanylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | CSCCCNC(=O)c1csc(-c2csc(Cn3c(CC[C@H](C)N)c4c(cc3=O)C3(CC3)NC4=O)n2)n1 |
| InChI | InChI=1S/C25H30N6O3S3/c1-14(26)4-5-18-21-15(25(6-7-25)30-23(21)34)10-20(32)31(18)11-19-28-17(13-36-19)24-29-16(12-37-24)22(33)27-8-3-9-35-2/h10,12-14H,3-9,11,26H2,1-2H3,(H,27,33)(H,30,34)/t14-/m0/s1 |
| InChIKey | NHGBXYNVVPMSJC-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|