About 2,4-dimethyl-1,2-thiazolidine
2,4-dimethyl-1,2-thiazolidine (PubChem CID 138705913) has the molecular formula C5H11NS
and a molecular weight of 117.22 g/mol. Its IUPAC name is 2,4-dimethyl-1,2-thiazolidine.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,2-thiazolidine |
| PubChem CID | 138705913 |
| Molecular Formula | C5H11NS |
| Molecular Weight | 117.22 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 2,4-dimethyl-1,2-thiazolidine |
| SMILES | CC1CSN(C)C1 |
| InChI | InChI=1S/C5H11NS/c1-5-3-6(2)7-4-5/h5H,3-4H2,1-2H3 |
| InChIKey | KFWKXPSTTMYMKQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1,2-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,2-thiazolidine?
The IUPAC name of 2,4-dimethyl-1,2-thiazolidine (CID 138705913) is 2,4-dimethyl-1,2-thiazolidine.
What is the SMILES notation for 2,4-dimethyl-1,2-thiazolidine?
The canonical SMILES for 2,4-dimethyl-1,2-thiazolidine is CC1CSN(C)C1.
What is the InChIKey of 2,4-dimethyl-1,2-thiazolidine?
The InChIKey is KFWKXPSTTMYMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS/c1-5-3-6(2)7-4-5/h5H,3-4H2,1-2H3.
What are the key properties of 2,4-dimethyl-1,2-thiazolidine?
2,4-dimethyl-1,2-thiazolidine has a molecular weight of 117.22 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,2-thiazolidine is sourced from PubChem (CID 138705913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).