C8H9FN2 — CID 138705960
4-fluoro-3,6-dimethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 138705960) has the molecular formula C8H9FN2 and a molecular weight of 152.17 g/mol. Its IUPAC name is 4-fluoro-3,6-dimethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-fluoro-3,6-dimethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 138705960 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 4-fluoro-3,6-dimethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C(C)=CC(F)=C(C)\C1=N/[H] |
| InChI | InChI=1S/C8H9FN2/c1-4-3-6(9)5(2)8(11)7(4)10/h3,10-11H,1-2H3/b10-7+,11-8+ |
| InChIKey | AQPAGRGBZOJCOH-AMMQDNIMSA-N |
| XLogP | 2.23 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|