C21H41N3 — CID 138706122
(1Z)-3-N-(3-ethyl-5-methylheptyl)-1-N-methyl-2-[(3-methylbut-2-enylamino)methyl]buta-1,3-diene-1,3-diamine (PubChem CID 138706122) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is (1Z)-3-N-(3-ethyl-5-methylheptyl)-1-N-methyl-2-[(3-methylbut-2-enylamino)methyl]buta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-3-N-(3-ethyl-5-methylheptyl)-1-N-methyl-2-[(3-methylbut-2-enylamino)methyl]buta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 138706122 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | (1Z)-3-N-(3-ethyl-5-methylheptyl)-1-N-methyl-2-[(3-methylbut-2-enylamino)methyl]buta-1,3-diene-1,3-diamine |
| SMILES | C=C(NCCC(CC)CC(C)CC)/C(=C\NC)CNCC=C(C)C |
| InChI | InChI=1S/C21H41N3/c1-8-18(5)14-20(9-2)11-13-24-19(6)21(15-22-7)16-23-12-10-17(3)4/h10,15,18,20,22-24H,6,8-9,11-14,16H2,1-5,7H3/b21-15- |
| InChIKey | DSXNMHHJUAINIA-QNGOZBTKSA-N |
| XLogP | 4.60 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|