C9H17N3 — CID 138706416
4-N,4-N,4-N',4-N'-tetramethyl-3H-pyridine-4,4-diamine (PubChem CID 138706416) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 4-N,4-N,4-N',4-N'-tetramethyl-3H-pyridine-4,4-diamine.
| Compound Name | 4-N,4-N,4-N',4-N'-tetramethyl-3H-pyridine-4,4-diamine |
|---|---|
| PubChem CID | 138706416 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 4-N,4-N,4-N',4-N'-tetramethyl-3H-pyridine-4,4-diamine |
| SMILES | CN(C)C1(N(C)C)C=CN=CC1 |
| InChI | InChI=1S/C9H17N3/c1-11(2)9(12(3)4)5-7-10-8-6-9/h5,7-8H,6H2,1-4H3 |
| InChIKey | GEACCWZFOVROSW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|