C11H15NO3 — CID 138706454
(2Z,3Z)-2-[2-oxo-2-(propylamino)ethylidene]hexa-3,5-dienoic acid (PubChem CID 138706454) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (2Z,3Z)-2-[2-oxo-2-(propylamino)ethylidene]hexa-3,5-dienoic acid.
| Compound Name | (2Z,3Z)-2-[2-oxo-2-(propylamino)ethylidene]hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 138706454 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2Z,3Z)-2-[2-oxo-2-(propylamino)ethylidene]hexa-3,5-dienoic acid |
| SMILES | C=C/C=C\C(=C\C(=O)NCCC)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-3-5-6-9(11(14)15)8-10(13)12-7-4-2/h3,5-6,8H,1,4,7H2,2H3,(H,12,13)(H,14,15)/b6-5-,9-8- |
| InChIKey | CDCUAJZLBCCTJS-AFJQJTPPSA-N |
| XLogP | 1.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|