About 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole
5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole (PubChem CID 138707772) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 138707772 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole |
| SMILES | CC1=CC(C(C)C)CN1 |
| InChI | InChI=1S/C8H15N/c1-6(2)8-4-7(3)9-5-8/h4,6,8-9H,5H2,1-3H3 |
| InChIKey | CRDMXPHJDKOGQR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole?
The IUPAC name of 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole (CID 138707772) is 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole is CC1=CC(C(C)C)CN1.
What is the InChIKey of 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole?
The InChIKey is CRDMXPHJDKOGQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-6(2)8-4-7(3)9-5-8/h4,6,8-9H,5H2,1-3H3.
What are the key properties of 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole?
5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole has a molecular weight of 125.21 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-propan-2-yl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 138707772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).