About N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide
N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide (PubChem CID 1387078) has the molecular formula C22H17N5O2
and a molecular weight of 383.41 g/mol. Its IUPAC name is N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 1387078 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide |
| SMILES | O=C(Nc1nc(NC(=O)c2ccccc2)n(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H17N5O2/c28-19(16-10-4-1-5-11-16)23-21-25-22(24-20(29)17-12-6-2-7-13-17)27(26-21)18-14-8-3-9-15-18/h1-15H,(H2,23,24,25,26,28,29) |
| InChIKey | GFQQPQUENQSFFY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide (CID 1387078) is N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide is O=C(Nc1nc(NC(=O)c2ccccc2)n(-c2ccccc2)n1)c1ccccc1.
What is the InChIKey of N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide?
The InChIKey is GFQQPQUENQSFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N5O2/c28-19(16-10-4-1-5-11-16)23-21-25-22(24-20(29)17-12-6-2-7-13-17)27(26-21)18-14-8-3-9-15-18/h1-15H,(H2,23,24,25,26,28,29).
What are the key properties of N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide?
N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide has a molecular weight of 383.41 g/mol, XLogP of 3.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzamido-1-phenyl-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 1387078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).