C18H27N3O3S — CID 138709584
(E,4S)-N-[4-(1-aminocyclopropyl)phenyl]sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide (PubChem CID 138709584) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is (E,4S)-N-[4-(1-aminocyclopropyl)phenyl]sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide.
| Compound Name | (E,4S)-N-[4-(1-aminocyclopropyl)phenyl]sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide |
|---|---|
| PubChem CID | 138709584 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (E,4S)-N-[4-(1-aminocyclopropyl)phenyl]sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide |
| SMILES | CN[C@H](/C=C(\C)C(=O)NS(=O)(=O)c1ccc(C2(N)CC2)cc1)C(C)C |
| InChI | InChI=1S/C18H27N3O3S/c1-12(2)16(20-4)11-13(3)17(22)21-25(23,24)15-7-5-14(6-8-15)18(19)9-10-18/h5-8,11-12,16,20H,9-10,19H2,1-4H3,(H,21,22)/b13-11+/t16-/m1/s1 |
| InChIKey | XOUQRUQWYFNNAW-SICOMBFOSA-N |
| XLogP | 1.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|