C20H26F3N3O4S — CID 138709679
(E,4S)-2,5-dimethyl-4-(methylamino)-N-[4-[1-[(2,2,2-trifluoroacetyl)amino]cyclopropyl]phenyl]sulfonylhex-2-enamide (PubChem CID 138709679) has the molecular formula C20H26F3N3O4S and a molecular weight of 461.51 g/mol. Its IUPAC name is (E,4S)-2,5-dimethyl-4-(methylamino)-N-[4-[1-[(2,2,2-trifluoroacetyl)amino]cyclopropyl]phenyl]sulfonylhex-2-enamide.
| Compound Name | (E,4S)-2,5-dimethyl-4-(methylamino)-N-[4-[1-[(2,2,2-trifluoroacetyl)amino]cyclopropyl]phenyl]sulfonylhex-2-enamide |
|---|---|
| PubChem CID | 138709679 |
| Molecular Formula | C20H26F3N3O4S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (E,4S)-2,5-dimethyl-4-(methylamino)-N-[4-[1-[(2,2,2-trifluoroacetyl)amino]cyclopropyl]phenyl]sulfonylhex-2-enamide |
| SMILES | CN[C@H](/C=C(\C)C(=O)NS(=O)(=O)c1ccc(C2(NC(=O)C(F)(F)F)CC2)cc1)C(C)C |
| InChI | InChI=1S/C20H26F3N3O4S/c1-12(2)16(24-4)11-13(3)17(27)26-31(29,30)15-7-5-14(6-8-15)19(9-10-19)25-18(28)20(21,22)23/h5-8,11-12,16,24H,9-10H2,1-4H3,(H,25,28)(H,26,27)/b13-11+/t16-/m1/s1 |
| InChIKey | PVZQNJRHHYJHQD-SICOMBFOSA-N |
| XLogP | 2.35 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|