C29H47IN4O6S — CID 138709708
(E,4S)-4-[[(2R)-3-iodo-3-methyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-N-(2-methoxyethylsulfonyl)-2,5-dimethylhex-2-enamide (PubChem CID 138709708) has the molecular formula C29H47IN4O6S and a molecular weight of 706.69 g/mol. Its IUPAC name is (E,4S)-4-[[(2R)-3-iodo-3-methyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-N-(2-methoxyethylsulfonyl)-2,5-dimethylhex-2-enamide.
| Compound Name | (E,4S)-4-[[(2R)-3-iodo-3-methyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-N-(2-methoxyethylsulfonyl)-2,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 138709708 |
| Molecular Formula | C29H47IN4O6S |
| Molecular Weight | 706.69 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | (E,4S)-4-[[(2R)-3-iodo-3-methyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-N-(2-methoxyethylsulfonyl)-2,5-dimethylhex-2-enamide |
| SMILES | CNC(C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)NS(=O)(=O)CCOC)C(C)C)C(C)(C)I)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C29H47IN4O6S/c1-19(2)22(18-20(3)25(35)33-41(38,39)17-16-40-10)34(9)27(37)24(29(6,7)30)32-26(36)23(31-8)28(4,5)21-14-12-11-13-15-21/h11-15,18-19,22-24,31H,16-17H2,1-10H3,(H,32,36)(H,33,35)/b20-18+/t22-,23?,24-/m1/s1 |
| InChIKey | OITWEHUZXYUPGN-LMGUHIFVSA-N |
| XLogP | 2.77 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|