C50H31NO3S — CID 138709770
10,10-dioxo-2-(9-phenylcarbazol-3-yl)-6-(9-phenyl-9H-fluoren-3-yl)thioxanthen-9-one (PubChem CID 138709770) has the molecular formula C50H31NO3S and a molecular weight of 725.87 g/mol. Its IUPAC name is 10,10-dioxo-2-(9-phenylcarbazol-3-yl)-6-(9-phenyl-9H-fluoren-3-yl)thioxanthen-9-one.
| Compound Name | 10,10-dioxo-2-(9-phenylcarbazol-3-yl)-6-(9-phenyl-9H-fluoren-3-yl)thioxanthen-9-one |
|---|---|
| PubChem CID | 138709770 |
| Molecular Formula | C50H31NO3S |
| Molecular Weight | 725.87 g/mol |
| Exact Mass | 725.20 |
| IUPAC Name | 10,10-dioxo-2-(9-phenylcarbazol-3-yl)-6-(9-phenyl-9H-fluoren-3-yl)thioxanthen-9-one |
| SMILES | O=C1c2cc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)ccc2S(=O)(=O)c2cc(-c3ccc4c(c3)-c3ccccc3C4c3ccccc3)ccc21 |
| InChI | InChI=1S/C50H31NO3S/c52-50-41-24-20-35(32-19-23-40-42(27-32)37-15-7-8-17-39(37)49(40)31-11-3-1-4-12-31)30-48(41)55(53,54)47-26-22-34(29-44(47)50)33-21-25-46-43(28-33)38-16-9-10-18-45(38)51(46)36-13-5-2-6-14-36/h1-30,49H |
| InChIKey | WOWKQBUHOWPZPN-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.87 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |