About (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate
(4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate (PubChem CID 138709980) has the molecular formula C18H16ClFN4O3
and a molecular weight of 390.80 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate |
| PubChem CID | 138709980 |
| Molecular Formula | C18H16ClFN4O3 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c(F)c1)N1CCO[C@H](c2nc3ncccc3[nH]2)C1 |
| InChI | InChI=1S/C18H16ClFN4O3/c19-12-4-3-11(8-13(12)20)10-27-18(25)24-6-7-26-15(9-24)17-22-14-2-1-5-21-16(14)23-17/h1-5,8,15H,6-7,9-10H2,(H,21,22,23)/t15-/m0/s1 |
| InChIKey | FLGVVVJPXFCZHQ-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate?
The IUPAC name of (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate (CID 138709980) is (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate.
What is the SMILES notation for (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate?
The canonical SMILES for (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate is O=C(OCc1ccc(Cl)c(F)c1)N1CCO[C@H](c2nc3ncccc3[nH]2)C1.
What is the InChIKey of (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate?
The InChIKey is FLGVVVJPXFCZHQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H16ClFN4O3/c19-12-4-3-11(8-13(12)20)10-27-18(25)24-6-7-26-15(9-24)17-22-14-2-1-5-21-16(14)23-17/h1-5,8,15H,6-7,9-10H2,(H,21,22,23)/t15-/m0/s1.
What are the key properties of (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate?
(4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate has a molecular weight of 390.80 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-fluorophenyl)methyl (2S)-2-(1H-imidazo[4,5-b]pyridin-2-yl)morpholine-4-carboxylate is sourced from PubChem (CID 138709980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).