C12H25NO — CID 138710397
6-amino-2,2,4,4,5,5-hexamethylhexan-3-one (PubChem CID 138710397) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 6-amino-2,2,4,4,5,5-hexamethylhexan-3-one.
| Compound Name | 6-amino-2,2,4,4,5,5-hexamethylhexan-3-one |
|---|---|
| PubChem CID | 138710397 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 6-amino-2,2,4,4,5,5-hexamethylhexan-3-one |
| SMILES | CC(C)(C)C(=O)C(C)(C)C(C)(C)CN |
| InChI | InChI=1S/C12H25NO/c1-10(2,3)9(14)12(6,7)11(4,5)8-13/h8,13H2,1-7H3 |
| InChIKey | HCPIQIGIJXZENU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |