C20H30N3O+ — CID 138710749
methyl N-[2,7-di(propan-2-yl)cyclohepta-1,3,6-trien-1-yl]-1,3-dimethylimidazol-1-ium-2-carboximidate (PubChem CID 138710749) has the molecular formula C20H30N3O+ and a molecular weight of 328.48 g/mol. Its IUPAC name is methyl N-[2,7-di(propan-2-yl)cyclohepta-1,3,6-trien-1-yl]-1,3-dimethylimidazol-1-ium-2-carboximidate.
| Compound Name | methyl N-[2,7-di(propan-2-yl)cyclohepta-1,3,6-trien-1-yl]-1,3-dimethylimidazol-1-ium-2-carboximidate |
|---|---|
| PubChem CID | 138710749 |
| Molecular Formula | C20H30N3O+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | methyl N-[2,7-di(propan-2-yl)cyclohepta-1,3,6-trien-1-yl]-1,3-dimethylimidazol-1-ium-2-carboximidate |
| SMILES | CO/C(=N\C1=C(C(C)C)C=CCC=C1C(C)C)c1n(C)cc[n+]1C |
| InChI | InChI=1S/C20H30N3O/c1-14(2)16-10-8-9-11-17(15(3)4)18(16)21-19(24-7)20-22(5)12-13-23(20)6/h8,10-15H,9H2,1-7H3/q+1/b21-19- |
| InChIKey | DHZPOYLJGAXPHD-VZCXRCSSSA-N |
| XLogP | 3.69 |
| TPSA | 30.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|