C13H17N3S — CID 138710820
(1E,3E,5Z)-6-(2,3-dihydropyridin-5-yl)-6-(methylideneamino)-1-methylsulfanylhexa-1,3,5-trien-2-amine (PubChem CID 138710820) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is (1E,3E,5Z)-6-(2,3-dihydropyridin-5-yl)-6-(methylideneamino)-1-methylsulfanylhexa-1,3,5-trien-2-amine.
| Compound Name | (1E,3E,5Z)-6-(2,3-dihydropyridin-5-yl)-6-(methylideneamino)-1-methylsulfanylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 138710820 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (1E,3E,5Z)-6-(2,3-dihydropyridin-5-yl)-6-(methylideneamino)-1-methylsulfanylhexa-1,3,5-trien-2-amine |
| SMILES | C=N/C(=C\C=C\C(N)=C/SC)C1=CCCN=C1 |
| InChI | InChI=1S/C13H17N3S/c1-15-13(11-5-4-8-16-9-11)7-3-6-12(14)10-17-2/h3,5-7,9-10H,1,4,8,14H2,2H3/b6-3+,12-10+,13-7- |
| InChIKey | MKJDJDYJFXMMBS-BTHCBILLSA-N |
| XLogP | 2.69 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|