C29H45N3 — CID 138711146
(2E,4E,6E)-N,7-dimethyl-4-[(4Z,7Z)-3-methylidene-1-azacyclododeca-4,7-dien-1-yl]-8-(1-methylpiperidin-4-yl)nona-2,4,6,8-tetraen-2-amine (PubChem CID 138711146) has the molecular formula C29H45N3 and a molecular weight of 435.70 g/mol. Its IUPAC name is (2E,4E,6E)-N,7-dimethyl-4-[(4Z,7Z)-3-methylidene-1-azacyclododeca-4,7-dien-1-yl]-8-(1-methylpiperidin-4-yl)nona-2,4,6,8-tetraen-2-amine.
| Compound Name | (2E,4E,6E)-N,7-dimethyl-4-[(4Z,7Z)-3-methylidene-1-azacyclododeca-4,7-dien-1-yl]-8-(1-methylpiperidin-4-yl)nona-2,4,6,8-tetraen-2-amine |
|---|---|
| PubChem CID | 138711146 |
| Molecular Formula | C29H45N3 |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 435.36 |
| IUPAC Name | (2E,4E,6E)-N,7-dimethyl-4-[(4Z,7Z)-3-methylidene-1-azacyclododeca-4,7-dien-1-yl]-8-(1-methylpiperidin-4-yl)nona-2,4,6,8-tetraen-2-amine |
| SMILES | C=C1/C=C\C/C=C\CCCCN(C(/C=C(\C)NC)=C/C=C(\C)C(=C)C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C29H45N3/c1-24-14-12-10-8-7-9-11-13-19-32(23-24)29(22-26(3)30-5)16-15-25(2)27(4)28-17-20-31(6)21-18-28/h7-8,12,14-16,22,28,30H,1,4,9-11,13,17-21,23H2,2-3,5-6H3/b8-7-,14-12-,25-15+,26-22+,29-16+ |
| InChIKey | OZYNDBOMHNKIMN-ZFPWTYLBSA-N |
| XLogP | 6.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|