About 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine
4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine (PubChem CID 138711192) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine |
| PubChem CID | 138711192 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine |
| SMILES | C/C=c1/c(C2CCN(C)CC2)c[nH]/c1=C/C |
| InChI | InChI=1S/C14H22N2/c1-4-12-13(10-15-14(12)5-2)11-6-8-16(3)9-7-11/h4-5,10-11,15H,6-9H2,1-3H3/b12-4-,14-5+ |
| InChIKey | UPPLOKKKEQXUBS-DTPPLFDSSA-N |
| XLogP | 1.42 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine?
The IUPAC name of 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine (CID 138711192) is 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine.
What is the SMILES notation for 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine?
The canonical SMILES for 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine is C/C=c1/c(C2CCN(C)CC2)c[nH]/c1=C/C.
What is the InChIKey of 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine?
The InChIKey is UPPLOKKKEQXUBS-DTPPLFDSSA-N. The full InChI is InChI=1S/C14H22N2/c1-4-12-13(10-15-14(12)5-2)11-6-8-16(3)9-7-11/h4-5,10-11,15H,6-9H2,1-3H3/b12-4-,14-5+.
What are the key properties of 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine?
4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine has a molecular weight of 218.34 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-1-methylpiperidine is sourced from PubChem (CID 138711192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).